C18H13Cl2N5O3S3 — CID 6887774
N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 6887774) has the molecular formula C18H13Cl2N5O3S3 and a molecular weight of 514.44 g/mol. Its IUPAC name is N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6887774 |
| Molecular Formula | C18H13Cl2N5O3S3 |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 512.96 |
| IUPAC Name | N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(SCc2ccc(Cl)cc2)s1)N/N=C/c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C18H13Cl2N5O3S3/c19-13-3-1-11(2-4-13)9-29-17-23-24-18(31-17)30-10-16(26)22-21-8-12-7-14(25(27)28)5-6-15(12)20/h1-8H,9-10H2,(H,22,26)/b21-8+ |
| InChIKey | CHUYARZGBAUWKL-ODCIPOBUSA-N |
| XLogP | 5.29 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|