C22H22N4O2S3 — CID 136904683
N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 136904683) has the molecular formula C22H22N4O2S3 and a molecular weight of 470.65 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 136904683 |
| Molecular Formula | C22H22N4O2S3 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCc1cccc(/C=N\NC(=O)CSc2nnc(SCc3ccc(C)cc3)s2)c1O |
| InChI | InChI=1S/C22H22N4O2S3/c1-3-5-17-6-4-7-18(20(17)28)12-23-24-19(27)14-30-22-26-25-21(31-22)29-13-16-10-8-15(2)9-11-16/h3-4,6-12,28H,1,5,13-14H2,2H3,(H,24,27)/b23-12- |
| InChIKey | OFGSXGAVMOXQRN-FMCGGJTJSA-N |
| XLogP | 4.82 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|