C24H22N4O3S3 — CID 135487270
N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 135487270) has the molecular formula C24H22N4O3S3 and a molecular weight of 510.67 g/mol. Its IUPAC name is N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135487270 |
| Molecular Formula | C24H22N4O3S3 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CCOc1cccc(/C=N/NC(=O)CSc2nnc(SCc3cccc4ccccc34)s2)c1O |
| InChI | InChI=1S/C24H22N4O3S3/c1-2-31-20-12-6-9-17(22(20)30)13-25-26-21(29)15-33-24-28-27-23(34-24)32-14-18-10-5-8-16-7-3-4-11-19(16)18/h3-13,30H,2,14-15H2,1H3,(H,26,29)/b25-13+ |
| InChIKey | IOHOGSAACPYKCA-DHRITJCHSA-N |
| XLogP | 5.33 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|