C21H19N5O3S3 — CID 6506969
2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide (PubChem CID 6506969) has the molecular formula C21H19N5O3S3 and a molecular weight of 485.62 g/mol. Its IUPAC name is 2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide.
| Compound Name | 2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 6506969 |
| Molecular Formula | C21H19N5O3S3 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 2-[[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
| SMILES | Cc1ccc(CSc2nnc(SCC(=O)N/N=C\C=C/c3ccccc3[N+](=O)[O-])s2)cc1 |
| InChI | InChI=1S/C21H19N5O3S3/c1-15-8-10-16(11-9-15)13-30-20-24-25-21(32-20)31-14-19(27)23-22-12-4-6-17-5-2-3-7-18(17)26(28)29/h2-12H,13-14H2,1H3,(H,23,27)/b6-4-,22-12- |
| InChIKey | OEZXBAYBDZDBNP-XPELHZPKSA-N |
| XLogP | 4.95 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|