C25H19ClN6O3S — CID 6887922
2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide (PubChem CID 6887922) has the molecular formula C25H19ClN6O3S and a molecular weight of 518.99 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 6887922 |
| Molecular Formula | C25H19ClN6O3S |
| Molecular Weight | 518.99 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccccc1)N/N=C/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H19ClN6O3S/c26-20-14-12-19(13-15-20)24-29-30-25(31(24)21-9-2-1-3-10-21)36-17-23(33)28-27-16-6-8-18-7-4-5-11-22(18)32(34)35/h1-16H,17H2,(H,28,33)/b8-6+,27-16+ |
| InChIKey | RXRCDSISIPEEDJ-AEQNYHIXSA-N |
| XLogP | 5.40 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.99 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|