C25H28N6O3S — CID 6866044
2-[[5-(4-tert-butylphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide (PubChem CID 6866044) has the molecular formula C25H28N6O3S and a molecular weight of 492.61 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 6866044 |
| Molecular Formula | C25H28N6O3S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
| SMILES | CCn1c(SCC(=O)N/N=C/C=C/c2ccccc2[N+](=O)[O-])nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H28N6O3S/c1-5-30-23(19-12-14-20(15-13-19)25(2,3)4)28-29-24(30)35-17-22(32)27-26-16-8-10-18-9-6-7-11-21(18)31(33)34/h6-16H,5,17H2,1-4H3,(H,27,32)/b10-8+,26-16+ |
| InChIKey | AYSYCPRDRPZIIG-LOBCTCGSSA-N |
| XLogP | 5.08 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|