C22H22N6O4S — CID 6506965
2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide (PubChem CID 6506965) has the molecular formula C22H22N6O4S and a molecular weight of 466.52 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide.
| Compound Name | 2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 6506965 |
| Molecular Formula | C22H22N6O4S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
| SMILES | CCn1c(SCC(=O)N/N=C\C=C/c2ccccc2[N+](=O)[O-])nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H22N6O4S/c1-3-27-21(17-10-12-18(32-2)13-11-17)25-26-22(27)33-15-20(29)24-23-14-6-8-16-7-4-5-9-19(16)28(30)31/h4-14H,3,15H2,1-2H3,(H,24,29)/b8-6-,23-14- |
| InChIKey | BRHAHRWMYXBSMZ-USQLSXKFSA-N |
| XLogP | 3.79 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|