C27H24N6O4S — CID 3645533
2-[[4-(4-methoxyphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide (PubChem CID 3645533) has the molecular formula C27H24N6O4S and a molecular weight of 528.59 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide.
| Compound Name | 2-[[4-(4-methoxyphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide |
|---|---|
| PubChem CID | 3645533 |
| Molecular Formula | C27H24N6O4S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)NN=CC=Cc3ccccc3[N+](=O)[O-])nnc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H24N6O4S/c1-19-9-11-21(12-10-19)26-30-31-27(32(26)22-13-15-23(37-2)16-14-22)38-18-25(34)29-28-17-5-7-20-6-3-4-8-24(20)33(35)36/h3-17H,18H2,1-2H3,(H,29,34) |
| InChIKey | JARIZNUMWQIRKD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|