C25H21ClN6O4S — CID 6886652
N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6886652) has the molecular formula C25H21ClN6O4S and a molecular weight of 537.00 g/mol. Its IUPAC name is N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6886652 |
| Molecular Formula | C25H21ClN6O4S |
| Molecular Weight | 537.00 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-2-[[5-(4-methoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(-c2nnc(SCC(=O)N/N=C/c3cc([N+](=O)[O-])ccc3Cl)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H21ClN6O4S/c1-16-3-7-19(8-4-16)31-24(17-5-10-21(36-2)11-6-17)29-30-25(31)37-15-23(33)28-27-14-18-13-20(32(34)35)9-12-22(18)26/h3-14H,15H2,1-2H3,(H,28,33)/b27-14+ |
| InChIKey | JJMCIGRPUPAHGG-MZJWZYIUSA-N |
| XLogP | 5.06 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.00 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|