C20H19N5O3S — CID 11958740
2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide (PubChem CID 11958740) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is 2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide.
| Compound Name | 2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 11958740 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[[(Z)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
| SMILES | CCn1c(SCC(=O)NN=C/C=C\c2ccccc2[N+](=O)[O-])nc2ccccc21 |
| InChI | InChI=1S/C20H19N5O3S/c1-2-24-18-12-6-4-10-16(18)22-20(24)29-14-19(26)23-21-13-7-9-15-8-3-5-11-17(15)25(27)28/h3-13H,2,14H2,1H3,(H,23,26)/b9-7-,21-13? |
| InChIKey | AAIJCFQQRWBAFC-YUOMWLQJSA-N |
| XLogP | 3.87 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_65_C(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|