C20H20N5O3S+ — CID 5050865
2-[(3-ethyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide (PubChem CID 5050865) has the molecular formula C20H20N5O3S+ and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-[(3-ethyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide.
| Compound Name | 2-[(3-ethyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide |
|---|---|
| PubChem CID | 5050865 |
| Molecular Formula | C20H20N5O3S+ |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[(3-ethyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide |
| SMILES | CC[n+]1c(SCC(=O)NN=CC=Cc2ccccc2[N+](=O)[O-])[nH]c2ccccc21 |
| InChI | InChI=1S/C20H19N5O3S/c1-2-24-18-12-6-4-10-16(18)22-20(24)29-14-19(26)23-21-13-7-9-15-8-3-5-11-17(15)25(27)28/h3-13H,2,14H2,1H3,(H,23,26)/p+1 |
| InChIKey | AAIJCFQQRWBAFC-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_65_C(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|