C22H22ClN5O2S — CID 3784739
2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-methoxyphenyl)prop-2-enylideneamino]acetamide (PubChem CID 3784739) has the molecular formula C22H22ClN5O2S and a molecular weight of 455.97 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-methoxyphenyl)prop-2-enylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-methoxyphenyl)prop-2-enylideneamino]acetamide |
|---|---|
| PubChem CID | 3784739 |
| Molecular Formula | C22H22ClN5O2S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(2-methoxyphenyl)prop-2-enylideneamino]acetamide |
| SMILES | CCn1c(SCC(=O)NN=CC=Cc2ccccc2OC)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClN5O2S/c1-3-28-21(17-10-12-18(23)13-11-17)26-27-22(28)31-15-20(29)25-24-14-6-8-16-7-4-5-9-19(16)30-2/h4-14H,3,15H2,1-2H3,(H,25,29) |
| InChIKey | OYEOISOAJXLSKZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|