C10H13N7OS2 — CID 17047877
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]acetamide (PubChem CID 17047877) has the molecular formula C10H13N7OS2 and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 17047877 |
| Molecular Formula | C10H13N7OS2 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]acetamide |
| SMILES | Cc1nn(C)cc1/C=N/NC(=O)CSc1nnc(N)s1 |
| InChI | InChI=1S/C10H13N7OS2/c1-6-7(4-17(2)16-6)3-12-13-8(18)5-19-10-15-14-9(11)20-10/h3-4H,5H2,1-2H3,(H2,11,14)(H,13,18)/b12-3+ |
| InChIKey | FRHCIJJSZYWRMP-KGVSQERTSA-N |
| XLogP | 0.40 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|