C23H24N8OS — CID 17047875
2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]acetamide (PubChem CID 17047875) has the molecular formula C23H24N8OS and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 17047875 |
| Molecular Formula | C23H24N8OS |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(1,3-dimethylpyrazol-4-yl)methylideneamino]acetamide |
| SMILES | Cc1nn(C)cc1/C=N/NC(=O)CSc1nnc(CNc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C23H24N8OS/c1-17-18(15-30(2)29-17)13-25-27-22(32)16-33-23-28-26-21(14-24-19-9-5-3-6-10-19)31(23)20-11-7-4-8-12-20/h3-13,15,24H,14,16H2,1-2H3,(H,27,32)/b25-13+ |
| InChIKey | IJYAHOZBANTAPD-DHRITJCHSA-N |
| XLogP | 3.16 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|