C23H28N6O6S — CID 11489210
2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]acetamide (PubChem CID 11489210) has the molecular formula C23H28N6O6S and a molecular weight of 516.58 g/mol. Its IUPAC name is 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]acetamide.
| Compound Name | 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]acetamide |
|---|---|
| PubChem CID | 11489210 |
| Molecular Formula | C23H28N6O6S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]acetamide |
| SMILES | O=C(CSc1nnc(CNc2ccccc2)n1-c1ccccc1)N/N=C/[C@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C23H28N6O6S/c30-13-18(32)22(35)21(34)17(31)11-25-27-20(33)14-36-23-28-26-19(12-24-15-7-3-1-4-8-15)29(23)16-9-5-2-6-10-16/h1-11,17-18,21-22,24,30-32,34-35H,12-14H2,(H,27,33)/b25-11+/t17-,18+,21-,22+/m0/s1 |
| InChIKey | PISATAPEECPUET-JZMFHCSVSA-N |
| XLogP | -0.49 |
| TPSA | 185.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|