C23H27FN6O6S — CID 11330070
2-[[5-[(4-fluoroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]acetamide (PubChem CID 11330070) has the molecular formula C23H27FN6O6S and a molecular weight of 534.57 g/mol. Its IUPAC name is 2-[[5-[(4-fluoroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]acetamide.
| Compound Name | 2-[[5-[(4-fluoroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]acetamide |
|---|---|
| PubChem CID | 11330070 |
| Molecular Formula | C23H27FN6O6S |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 2-[[5-[(4-fluoroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]acetamide |
| SMILES | O=C(CSc1nnc(CNc2ccc(F)cc2)n1-c1ccccc1)N/N=C/[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C23H27FN6O6S/c24-14-6-8-15(9-7-14)25-11-19-27-29-23(30(19)16-4-2-1-3-5-16)37-13-20(34)28-26-10-17(32)21(35)22(36)18(33)12-31/h1-10,17-18,21-22,25,31-33,35-36H,11-13H2,(H,28,34)/b26-10+/t17-,18-,21-,22-/m1/s1 |
| InChIKey | IOZBKWNLCJNJNB-FIFVAYDGSA-N |
| XLogP | -0.35 |
| TPSA | 185.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|