C25H24N6O3S — CID 135685237
2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]acetamide (PubChem CID 135685237) has the molecular formula C25H24N6O3S and a molecular weight of 488.57 g/mol. Its IUPAC name is 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135685237 |
| Molecular Formula | C25H24N6O3S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(O)c(/C=N/NC(=O)CSc2nnc(CNc3ccccc3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C25H24N6O3S/c1-34-21-12-13-22(32)18(14-21)15-27-29-24(33)17-35-25-30-28-23(16-26-19-8-4-2-5-9-19)31(25)20-10-6-3-7-11-20/h2-15,26,32H,16-17H2,1H3,(H,29,33)/b27-15+ |
| InChIKey | IHJSFDJDAZRVRU-JFLMPSFJSA-N |
| XLogP | 3.84 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|