C19H18BrN5O3S — CID 4764951
2-[[5-(2-bromophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-5-methoxyphenyl)methylideneamino]acetamide (PubChem CID 4764951) has the molecular formula C19H18BrN5O3S and a molecular weight of 476.36 g/mol. Its IUPAC name is 2-[[5-(2-bromophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-5-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(2-bromophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-5-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4764951 |
| Molecular Formula | C19H18BrN5O3S |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 2-[[5-(2-bromophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-5-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(O)c(C=NNC(=O)CSc2nnc(-c3ccccc3Br)n2C)c1 |
| InChI | InChI=1S/C19H18BrN5O3S/c1-25-18(14-5-3-4-6-15(14)20)23-24-19(25)29-11-17(27)22-21-10-12-9-13(28-2)7-8-16(12)26/h3-10,26H,11H2,1-2H3,(H,22,27) |
| InChIKey | FBZXMWFPKDGMHA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|