C20H19Br2N5O3S — CID 6861727
N-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[5-(3-bromophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6861727) has the molecular formula C20H19Br2N5O3S and a molecular weight of 569.28 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[5-(3-bromophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[5-(3-bromophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6861727 |
| Molecular Formula | C20H19Br2N5O3S |
| Molecular Weight | 569.28 g/mol |
| Exact Mass | 566.96 |
| IUPAC Name | N-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[5-(3-bromophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1cc(OC)c(/C=N/NC(=O)CSc2nnc(-c3cccc(Br)c3)n2C)cc1Br |
| InChI | InChI=1S/C20H19Br2N5O3S/c1-27-19(12-5-4-6-14(21)7-12)25-26-20(27)31-11-18(28)24-23-10-13-8-15(22)17(30-3)9-16(13)29-2/h4-10H,11H2,1-3H3,(H,24,28)/b23-10+ |
| InChIKey | KBBXPJOJXSVDIO-AUEPDCJTSA-N |
| XLogP | 4.27 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|