C25H22BrN5O3S — CID 4509935
2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 4509935) has the molecular formula C25H22BrN5O3S and a molecular weight of 552.45 g/mol. Its IUPAC name is 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4509935 |
| Molecular Formula | C25H22BrN5O3S |
| Molecular Weight | 552.45 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cccc(C=NNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccc(Br)cc2)c1OC |
| InChI | InChI=1S/C25H22BrN5O3S/c1-33-21-10-6-9-18(23(21)34-2)15-27-28-22(32)16-35-25-30-29-24(17-7-4-3-5-8-17)31(25)20-13-11-19(26)12-14-20/h3-15H,16H2,1-2H3,(H,28,32) |
| InChIKey | WPRAUSRGFOBHSA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|