C26H23N5O5S — CID 2222731
6-[[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid (PubChem CID 2222731) has the molecular formula C26H23N5O5S and a molecular weight of 517.57 g/mol. Its IUPAC name is 6-[[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid.
| Compound Name | 6-[[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 2222731 |
| Molecular Formula | C26H23N5O5S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 6-[[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoic acid |
| SMILES | COc1ccc(C=NNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccccc2)c(C(=O)O)c1OC |
| InChI | InChI=1S/C26H23N5O5S/c1-35-20-14-13-18(22(25(33)34)23(20)36-2)15-27-28-21(32)16-37-26-30-29-24(17-9-5-3-6-10-17)31(26)19-11-7-4-8-12-19/h3-15H,16H2,1-2H3,(H,28,32)(H,33,34) |
| InChIKey | WTBLYHVIPLHTDF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|