C19H17N7O7S — CID 135716735
N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-[[4-methyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 135716735) has the molecular formula C19H17N7O7S and a molecular weight of 487.45 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-[[4-methyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-[[4-methyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135716735 |
| Molecular Formula | C19H17N7O7S |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-[[4-methyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=N/NC(=O)CSc2nnc(-c3cccc([N+](=O)[O-])c3)n2C)c1O |
| InChI | InChI=1S/C19H17N7O7S/c1-24-18(11-4-3-5-13(6-11)25(29)30)22-23-19(24)34-10-16(27)21-20-9-12-7-14(26(31)32)8-15(33-2)17(12)28/h3-9,28H,10H2,1-2H3,(H,21,27)/b20-9+ |
| InChIKey | MWCJNYPQJQALHO-AWQFTUOYSA-N |
| XLogP | 2.26 |
| TPSA | 187.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|