C18H15BrClN5OS — CID 6208453
N-[(Z)-(3-bromophenyl)methylideneamino]-2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6208453) has the molecular formula C18H15BrClN5OS and a molecular weight of 464.78 g/mol. Its IUPAC name is N-[(Z)-(3-bromophenyl)methylideneamino]-2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-(3-bromophenyl)methylideneamino]-2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6208453 |
| Molecular Formula | C18H15BrClN5OS |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 462.99 |
| IUPAC Name | N-[(Z)-(3-bromophenyl)methylideneamino]-2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cn1c(SCC(=O)N/N=C\c2cccc(Br)c2)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C18H15BrClN5OS/c1-25-17(14-7-2-3-8-15(14)20)23-24-18(25)27-11-16(26)22-21-10-12-5-4-6-13(19)9-12/h2-10H,11H2,1H3,(H,22,26)/b21-10- |
| InChIKey | WPVFYUYVMRZACO-FBHDLOMBSA-N |
| XLogP | 4.14 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|