C13H14BrN5O3S2 — CID 135597829
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135597829) has the molecular formula C13H14BrN5O3S2 and a molecular weight of 432.33 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135597829 |
| Molecular Formula | C13H14BrN5O3S2 |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(C=NNC(=O)CSc2nnc(N)s2)cc(Br)c1O |
| InChI | InChI=1S/C13H14BrN5O3S2/c1-2-22-9-4-7(3-8(14)11(9)21)5-16-17-10(20)6-23-13-19-18-12(15)24-13/h3-5,21H,2,6H2,1H3,(H2,15,18)(H,17,20) |
| InChIKey | FUOAUDYKBJJZTO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|