C19H16BrCl2N5O3S2 — CID 19204448
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide (PubChem CID 19204448) has the molecular formula C19H16BrCl2N5O3S2 and a molecular weight of 577.31 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 19204448 |
| Molecular Formula | C19H16BrCl2N5O3S2 |
| Molecular Weight | 577.31 g/mol |
| Exact Mass | 574.93 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(C=NNC(=O)CSc2nnc(N)s2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16BrCl2N5O3S2/c1-29-15-5-10(7-24-25-16(28)9-31-19-27-26-18(23)32-19)4-13(20)17(15)30-8-11-2-3-12(21)6-14(11)22/h2-7H,8-9H2,1H3,(H2,23,26)(H,25,28) |
| InChIKey | SPWZJMQTEBXCPO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.31 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|