C18H18BrCl2N3O2S — CID 94851535
1-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethylthiourea (PubChem CID 94851535) has the molecular formula C18H18BrCl2N3O2S and a molecular weight of 491.24 g/mol. Its IUPAC name is 1-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 94851535 |
| Molecular Formula | C18H18BrCl2N3O2S |
| Molecular Weight | 491.24 g/mol |
| Exact Mass | 488.97 |
| IUPAC Name | 1-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C\c1cc(Br)c(OCc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H18BrCl2N3O2S/c1-3-22-18(27)24-23-9-11-6-14(19)17(16(7-11)25-2)26-10-12-4-5-13(20)8-15(12)21/h4-9H,3,10H2,1-2H3,(H2,22,24,27)/b23-9- |
| InChIKey | QPILTTKCWXEUNL-AQHIEDMUSA-N |
| XLogP | 5.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.24 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|