C23H19BrCl2N2O3 — CID 19060863
N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-methylbenzamide (PubChem CID 19060863) has the molecular formula C23H19BrCl2N2O3 and a molecular weight of 522.23 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-methylbenzamide.
| Compound Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-methylbenzamide |
|---|---|
| PubChem CID | 19060863 |
| Molecular Formula | C23H19BrCl2N2O3 |
| Molecular Weight | 522.23 g/mol |
| Exact Mass | 520.00 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-methylbenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccccc2C)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H19BrCl2N2O3/c1-14-5-3-4-6-18(14)23(29)28-27-12-15-9-19(24)22(21(10-15)30-2)31-13-16-7-8-17(25)11-20(16)26/h3-12H,13H2,1-2H3,(H,28,29)/b27-12+ |
| InChIKey | NPNLYBCVLAPJJH-KKMKTNMSSA-N |
| XLogP | 6.42 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.23 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|