C22H16Cl2I2N2O2 — CID 99665225
N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-methylbenzamide (PubChem CID 99665225) has the molecular formula C22H16Cl2I2N2O2 and a molecular weight of 665.10 g/mol. Its IUPAC name is N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-methylbenzamide.
| Compound Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-methylbenzamide |
|---|---|
| PubChem CID | 99665225 |
| Molecular Formula | C22H16Cl2I2N2O2 |
| Molecular Weight | 665.10 g/mol |
| Exact Mass | 663.87 |
| IUPAC Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N/N=C\c1cc(I)c(OCc2ccc(Cl)cc2Cl)c(I)c1 |
| InChI | InChI=1S/C22H16Cl2I2N2O2/c1-13-4-2-3-5-17(13)22(29)28-27-11-14-8-19(25)21(20(26)9-14)30-12-15-6-7-16(23)10-18(15)24/h2-11H,12H2,1H3,(H,28,29)/b27-11- |
| InChIKey | ADJBVEBADMCKCJ-BCHBDCPOSA-N |
| XLogP | 6.85 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.10 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|