C19H12Cl2I2N2O3 — CID 21380054
N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]furan-2-carboxamide (PubChem CID 21380054) has the molecular formula C19H12Cl2I2N2O3 and a molecular weight of 641.03 g/mol. Its IUPAC name is N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 21380054 |
| Molecular Formula | C19H12Cl2I2N2O3 |
| Molecular Weight | 641.03 g/mol |
| Exact Mass | 639.83 |
| IUPAC Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]furan-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc(I)c(OCc2ccc(Cl)cc2Cl)c(I)c1)c1ccco1 |
| InChI | InChI=1S/C19H12Cl2I2N2O3/c20-13-4-3-12(14(21)8-13)10-28-18-15(22)6-11(7-16(18)23)9-24-25-19(26)17-2-1-5-27-17/h1-9H,10H2,(H,25,26)/b24-9+ |
| InChIKey | YPLBNYZTHZVNFR-PGGKNCGUSA-N |
| XLogP | 6.14 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.03 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|