C22H16BrCl2IN2O3 — CID 126374011
4-bromo-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]benzamide (PubChem CID 126374011) has the molecular formula C22H16BrCl2IN2O3 and a molecular weight of 634.10 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | 4-bromo-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126374011 |
| Molecular Formula | C22H16BrCl2IN2O3 |
| Molecular Weight | 634.10 g/mol |
| Exact Mass | 631.88 |
| IUPAC Name | 4-bromo-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(Br)cc2)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H16BrCl2IN2O3/c1-30-20-9-13(11-27-28-22(29)14-2-5-16(23)6-3-14)8-19(26)21(20)31-12-15-4-7-17(24)10-18(15)25/h2-11H,12H2,1H3,(H,28,29)/b27-11- |
| InChIKey | LFAZOFBUHFGQNC-BCHBDCPOSA-N |
| XLogP | 6.71 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.10 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|