C22H16BrCl3N2O4 — CID 124558600
5-bromo-N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxybenzamide (PubChem CID 124558600) has the molecular formula C22H16BrCl3N2O4 and a molecular weight of 558.64 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 124558600 |
| Molecular Formula | C22H16BrCl3N2O4 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 555.94 |
| IUPAC Name | 5-bromo-N-[(Z)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-hydroxybenzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc(Br)ccc2O)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H16BrCl3N2O4/c1-31-20-7-12(10-27-28-22(30)16-8-14(23)3-5-19(16)29)6-18(26)21(20)32-11-13-2-4-15(24)9-17(13)25/h2-10,29H,11H2,1H3,(H,28,30)/b27-10- |
| InChIKey | GEPUDUUHDPTEMO-NCAUGAEKSA-N |
| XLogP | 6.47 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|