C23H19Cl2IN2O4 — CID 126145584
N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-methoxybenzamide (PubChem CID 126145584) has the molecular formula C23H19Cl2IN2O4 and a molecular weight of 585.23 g/mol. Its IUPAC name is N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-methoxybenzamide.
| Compound Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 126145584 |
| Molecular Formula | C23H19Cl2IN2O4 |
| Molecular Weight | 585.23 g/mol |
| Exact Mass | 583.98 |
| IUPAC Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N/N=C\c1cc(I)c(OCc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C23H19Cl2IN2O4/c1-30-20-6-4-3-5-17(20)23(29)28-27-12-14-9-19(26)22(21(10-14)31-2)32-13-15-7-8-16(24)11-18(15)25/h3-12H,13H2,1-2H3,(H,28,29)/b27-12- |
| InChIKey | CHCLFLSKXHWIIB-PPDIBHTLSA-N |
| XLogP | 5.96 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.23 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|