C23H19Cl3IN3O3 — CID 126367601
2-(4-chloroanilino)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide (PubChem CID 126367601) has the molecular formula C23H19Cl3IN3O3 and a molecular weight of 618.69 g/mol. Its IUPAC name is 2-(4-chloroanilino)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chloroanilino)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126367601 |
| Molecular Formula | C23H19Cl3IN3O3 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 616.95 |
| IUPAC Name | 2-(4-chloroanilino)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CNc2ccc(Cl)cc2)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H19Cl3IN3O3/c1-32-21-9-14(11-29-30-22(31)12-28-18-6-4-16(24)5-7-18)8-20(27)23(21)33-13-15-2-3-17(25)10-19(15)26/h2-11,28H,12-13H2,1H3,(H,30,31)/b29-11- |
| InChIKey | JXRXZRZDZWXHFI-KYMQWJLESA-N |
| XLogP | 6.40 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|