C25H22Cl2IN3O5 — CID 4232210
2-(1,3-benzodioxol-5-ylamino)-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]acetamide (PubChem CID 4232210) has the molecular formula C25H22Cl2IN3O5 and a molecular weight of 642.28 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4232210 |
| Molecular Formula | C25H22Cl2IN3O5 |
| Molecular Weight | 642.28 g/mol |
| Exact Mass | 641.00 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(C=NNC(=O)CNc2ccc3c(c2)OCO3)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H22Cl2IN3O5/c1-2-33-23-8-15(7-20(28)25(23)34-13-16-3-4-17(26)9-19(16)27)11-30-31-24(32)12-29-18-5-6-21-22(10-18)36-14-35-21/h3-11,29H,2,12-14H2,1H3,(H,31,32) |
| InChIKey | IIZMYCJRIMQBEF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.28 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|