C18H18IN3O5 — CID 46738470
2-(1,3-benzodioxol-5-ylamino)-N-[(E)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 46738470) has the molecular formula C18H18IN3O5 and a molecular weight of 483.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-[(E)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-[(E)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 46738470 |
| Molecular Formula | C18H18IN3O5 |
| Molecular Weight | 483.26 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-[(E)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)CNc2ccc3c(c2)OCO3)cc(I)c1OC |
| InChI | InChI=1S/C18H18IN3O5/c1-24-16-6-11(5-13(19)18(16)25-2)8-21-22-17(23)9-20-12-3-4-14-15(7-12)27-10-26-14/h3-8,20H,9-10H2,1-2H3,(H,22,23)/b21-8+ |
| InChIKey | WGKVSEMATFALLT-ODCIPOBUSA-N |
| XLogP | 2.60 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|