C18H18BrN3O5 — CID 1271423
2-(1,3-benzodioxol-5-ylamino)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 1271423) has the molecular formula C18H18BrN3O5 and a molecular weight of 436.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1271423 |
| Molecular Formula | C18H18BrN3O5 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(C=NNC(=O)CNc2ccc3c(c2)OCO3)cc(Br)c1O |
| InChI | InChI=1S/C18H18BrN3O5/c1-2-25-16-6-11(5-13(19)18(16)24)8-21-22-17(23)9-20-12-3-4-14-15(7-12)27-10-26-14/h3-8,20,24H,2,9-10H2,1H3,(H,22,23) |
| InChIKey | TYAYPXLERICZFQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|