C23H18Br3N3O4 — CID 4076916
2-(1,3-benzodioxol-5-ylamino)-N-[[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 4076916) has the molecular formula C23H18Br3N3O4 and a molecular weight of 640.13 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-[[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-[[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4076916 |
| Molecular Formula | C23H18Br3N3O4 |
| Molecular Weight | 640.13 g/mol |
| Exact Mass | 636.88 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-[[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(CNc1ccc2c(c1)OCO2)NN=Cc1cc(Br)c(OCc2ccc(Br)cc2)c(Br)c1 |
| InChI | InChI=1S/C23H18Br3N3O4/c24-16-3-1-14(2-4-16)12-31-23-18(25)7-15(8-19(23)26)10-28-29-22(30)11-27-17-5-6-20-21(9-17)33-13-32-20/h1-10,27H,11-13H2,(H,29,30) |
| InChIKey | UQDBUYQEJPEVGN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.13 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|