C22H17Br2ClN4O4 — CID 126371268
2-(4-chloroanilino)-N-[(Z)-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 126371268) has the molecular formula C22H17Br2ClN4O4 and a molecular weight of 596.66 g/mol. Its IUPAC name is 2-(4-chloroanilino)-N-[(Z)-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chloroanilino)-N-[(Z)-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126371268 |
| Molecular Formula | C22H17Br2ClN4O4 |
| Molecular Weight | 596.66 g/mol |
| Exact Mass | 593.93 |
| IUPAC Name | 2-(4-chloroanilino)-N-[(Z)-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(CNc1ccc(Cl)cc1)N/N=C\c1cc(Br)c(OCc2ccc([N+](=O)[O-])cc2)c(Br)c1 |
| InChI | InChI=1S/C22H17Br2ClN4O4/c23-19-9-15(11-27-28-21(30)12-26-17-5-3-16(25)4-6-17)10-20(24)22(19)33-13-14-1-7-18(8-2-14)29(31)32/h1-11,26H,12-13H2,(H,28,30)/b27-11- |
| InChIKey | WVFXBRSCEUGEOT-BCHBDCPOSA-N |
| XLogP | 5.91 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|