C23H19Br2ClN2O2 — CID 126364041
N-[(E)-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)acetamide (PubChem CID 126364041) has the molecular formula C23H19Br2ClN2O2 and a molecular weight of 550.68 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126364041 |
| Molecular Formula | C23H19Br2ClN2O2 |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 547.95 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C/c2cc(Br)c(OCc3ccc(Cl)cc3)c(Br)c2)cc1 |
| InChI | InChI=1S/C23H19Br2ClN2O2/c1-15-2-4-16(5-3-15)12-22(29)28-27-13-18-10-20(24)23(21(25)11-18)30-14-17-6-8-19(26)9-7-17/h2-11,13H,12,14H2,1H3,(H,28,29)/b27-13+ |
| InChIKey | HYZGMBGIPAPGDL-UVHMKAGCSA-N |
| XLogP | 6.45 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|