C24H21ClI2N2O2 — CID 99944614
N-[(E)-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 99944614) has the molecular formula C24H21ClI2N2O2 and a molecular weight of 658.71 g/mol. Its IUPAC name is N-[(E)-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 99944614 |
| Molecular Formula | C24H21ClI2N2O2 |
| Molecular Weight | 658.71 g/mol |
| Exact Mass | 657.94 |
| IUPAC Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C/c2cc(I)c(OCc3ccc(Cl)cc3)c(I)c2)c(C)c1 |
| InChI | InChI=1S/C24H21ClI2N2O2/c1-15-3-6-19(16(2)9-15)12-23(30)29-28-13-18-10-21(26)24(22(27)11-18)31-14-17-4-7-20(25)8-5-17/h3-11,13H,12,14H2,1-2H3,(H,29,30)/b28-13+ |
| InChIKey | CYSJBPBHPFQVBE-XODNFHPESA-N |
| XLogP | 6.44 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.71 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|