C27H26ClN3O3 — CID 92657931
N-[(Z)-[3-chloro-4-[(4-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 92657931) has the molecular formula C27H26ClN3O3 and a molecular weight of 475.98 g/mol. Its IUPAC name is N-[(Z)-[3-chloro-4-[(4-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(Z)-[3-chloro-4-[(4-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 92657931 |
| Molecular Formula | C27H26ClN3O3 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-[(Z)-[3-chloro-4-[(4-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2ccc(C)cc2C)cc(Cl)c1OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H26ClN3O3/c1-4-33-25-13-22(16-30-31-26(32)14-23-10-5-18(2)11-19(23)3)12-24(28)27(25)34-17-21-8-6-20(15-29)7-9-21/h5-13,16H,4,14,17H2,1-3H3,(H,31,32)/b30-16- |
| InChIKey | XGCOCPUASZDMEY-UHBFCERESA-N |
| XLogP | 5.50 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|