C26H26Cl2N2O3 — CID 126368624
N-[(E)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-ethylphenyl)acetamide (PubChem CID 126368624) has the molecular formula C26H26Cl2N2O3 and a molecular weight of 485.41 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-ethylphenyl)acetamide.
| Compound Name | N-[(E)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126368624 |
| Molecular Formula | C26H26Cl2N2O3 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | N-[(E)-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-ethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2ccc(CC)cc2)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H26Cl2N2O3/c1-3-18-5-7-19(8-6-18)15-25(31)30-29-16-21-13-23(28)26(24(14-21)32-4-2)33-17-20-9-11-22(27)12-10-20/h5-14,16H,3-4,15,17H2,1-2H3,(H,30,31)/b29-16+ |
| InChIKey | NUXIRNOOYVHQGD-MUFRIFMGSA-N |
| XLogP | 6.23 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|