C19H21ClN2O3 — CID 133144006
N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 133144006) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 133144006 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cc2ccc(C)cc2C)cc(Cl)c1OC |
| InChI | InChI=1S/C19H21ClN2O3/c1-12-5-6-15(13(2)7-12)10-18(23)22-21-11-14-8-16(20)19(25-4)17(9-14)24-3/h5-9,11H,10H2,1-4H3,(H,22,23)/b21-11+ |
| InChIKey | AFZAWODHWMFXKK-SRZZPIQSSA-N |
| XLogP | 3.67 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|