C17H16Cl2N2O — CID 133170937
N-[(E)-(3,4-dichlorophenyl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 133170937) has the molecular formula C17H16Cl2N2O and a molecular weight of 335.23 g/mol. Its IUPAC name is N-[(E)-(3,4-dichlorophenyl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(E)-(3,4-dichlorophenyl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 133170937 |
| Molecular Formula | C17H16Cl2N2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | N-[(E)-(3,4-dichlorophenyl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C/c2ccc(Cl)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C17H16Cl2N2O/c1-11-3-5-14(12(2)7-11)9-17(22)21-20-10-13-4-6-15(18)16(19)8-13/h3-8,10H,9H2,1-2H3,(H,21,22)/b20-10+ |
| InChIKey | PGRNDLRRVUZSGC-KEBDBYFISA-N |
| XLogP | 4.30 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|