C17H17IN2O — CID 99944759
2-(2,4-dimethylphenyl)-N-[(E)-(3-iodophenyl)methylideneamino]acetamide (PubChem CID 99944759) has the molecular formula C17H17IN2O and a molecular weight of 392.24 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-[(E)-(3-iodophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-[(E)-(3-iodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 99944759 |
| Molecular Formula | C17H17IN2O |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-[(E)-(3-iodophenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C/c2cccc(I)c2)c(C)c1 |
| InChI | InChI=1S/C17H17IN2O/c1-12-6-7-15(13(2)8-12)10-17(21)20-19-11-14-4-3-5-16(18)9-14/h3-9,11H,10H2,1-2H3,(H,20,21)/b19-11+ |
| InChIKey | ZKGFHXCCGRXGAV-YBFXNURJSA-N |
| XLogP | 3.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|