C17H18N2O — CID 133143773
N-[(E)-benzylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 133143773) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(E)-benzylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 133143773 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C/c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C17H18N2O/c1-13-8-9-16(14(2)10-13)11-17(20)19-18-12-15-6-4-3-5-7-15/h3-10,12H,11H2,1-2H3,(H,19,20)/b18-12+ |
| InChIKey | LCRHCIXUKIQQOT-LDADJPATSA-N |
| XLogP | 3.00 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|