C15H11Cl2FN2O — CID 7428714
N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(4-fluorophenyl)acetamide (PubChem CID 7428714) has the molecular formula C15H11Cl2FN2O and a molecular weight of 325.17 g/mol. Its IUPAC name is N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 7428714 |
| Molecular Formula | C15H11Cl2FN2O |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)N/N=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2FN2O/c16-13-6-3-11(7-14(13)17)9-19-20-15(21)8-10-1-4-12(18)5-2-10/h1-7,9H,8H2,(H,20,21)/b19-9- |
| InChIKey | CSCQOFQAJFEGLP-OCKHKDLRSA-N |
| XLogP | 3.83 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|