C22H25IN2O5 — CID 92657956
methyl 2-[4-[(Z)-[[2-(2,4-dimethylphenyl)acetyl]hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 92657956) has the molecular formula C22H25IN2O5 and a molecular weight of 524.36 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[[2-(2,4-dimethylphenyl)acetyl]hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[[2-(2,4-dimethylphenyl)acetyl]hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 92657956 |
| Molecular Formula | C22H25IN2O5 |
| Molecular Weight | 524.36 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | methyl 2-[4-[(Z)-[[2-(2,4-dimethylphenyl)acetyl]hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2ccc(C)cc2C)cc(I)c1OCC(=O)OC |
| InChI | InChI=1S/C22H25IN2O5/c1-5-29-19-10-16(9-18(23)22(19)30-13-21(27)28-4)12-24-25-20(26)11-17-7-6-14(2)8-15(17)3/h6-10,12H,5,11,13H2,1-4H3,(H,25,26)/b24-12- |
| InChIKey | YWKINEBIVIIHMQ-MSXFZWOLSA-N |
| XLogP | 3.55 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|