C30H29IN2O3 — CID 126364397
2-(2,5-dimethylphenyl)-N-[(E)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide (PubChem CID 126364397) has the molecular formula C30H29IN2O3 and a molecular weight of 592.48 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-[(E)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2,5-dimethylphenyl)-N-[(E)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126364397 |
| Molecular Formula | C30H29IN2O3 |
| Molecular Weight | 592.48 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-[(E)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2cc(C)ccc2C)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C30H29IN2O3/c1-4-35-28-16-22(18-32-33-29(34)17-25-14-20(2)12-13-21(25)3)15-27(31)30(28)36-19-24-10-7-9-23-8-5-6-11-26(23)24/h5-16,18H,4,17,19H2,1-3H3,(H,33,34)/b32-18+ |
| InChIKey | BKWDBLCBXWCCAT-KCSSXMTESA-N |
| XLogP | 6.73 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.48 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|