C26H27IN2O5 — CID 3717028
N-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide (PubChem CID 3717028) has the molecular formula C26H27IN2O5 and a molecular weight of 574.42 g/mol. Its IUPAC name is N-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide.
| Compound Name | N-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 3717028 |
| Molecular Formula | C26H27IN2O5 |
| Molecular Weight | 574.42 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | N-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
| SMILES | CCOc1cc(C=NNC(=O)CC2(C)OCCO2)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C26H27IN2O5/c1-3-31-23-14-18(16-28-29-24(30)15-26(2)33-11-12-34-26)13-22(27)25(23)32-17-20-9-6-8-19-7-4-5-10-21(19)20/h4-10,13-14,16H,3,11-12,15,17H2,1-2H3,(H,29,30) |
| InChIKey | XUFIRFNZPLKSJM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|